C17H20BrNO3 — CID 139259760
1-(4-bromophenyl)-3-(4-oxoheptan-3-yl)pyrrolidine-2,5-dione (PubChem CID 139259760) has the molecular formula C17H20BrNO3 and a molecular weight of 366.26 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-(4-oxoheptan-3-yl)pyrrolidine-2,5-dione.
| Compound Name | 1-(4-bromophenyl)-3-(4-oxoheptan-3-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 139259760 |
| Molecular Formula | C17H20BrNO3 |
| Molecular Weight | 366.26 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | 1-(4-bromophenyl)-3-(4-oxoheptan-3-yl)pyrrolidine-2,5-dione |
| SMILES | CCCC(=O)C(CC)C1CC(=O)N(c2ccc(Br)cc2)C1=O |
| InChI | InChI=1S/C17H20BrNO3/c1-3-5-15(20)13(4-2)14-10-16(21)19(17(14)22)12-8-6-11(18)7-9-12/h6-9,13-14H,3-5,10H2,1-2H3 |
| InChIKey | HMNRHAAMIZGRTL-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.26 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|