C27H42N2O4 — CID 121323600
3-[4-(3-nonan-4-yl-2,5-dioxopyrrolidin-1-yl)phenyl]-N-(2-propoxyethyl)propanamide (PubChem CID 121323600) has the molecular formula C27H42N2O4 and a molecular weight of 458.64 g/mol. Its IUPAC name is 3-[4-(3-nonan-4-yl-2,5-dioxopyrrolidin-1-yl)phenyl]-N-(2-propoxyethyl)propanamide.
| Compound Name | 3-[4-(3-nonan-4-yl-2,5-dioxopyrrolidin-1-yl)phenyl]-N-(2-propoxyethyl)propanamide |
|---|---|
| PubChem CID | 121323600 |
| Molecular Formula | C27H42N2O4 |
| Molecular Weight | 458.64 g/mol |
| Exact Mass | 458.31 |
| IUPAC Name | 3-[4-(3-nonan-4-yl-2,5-dioxopyrrolidin-1-yl)phenyl]-N-(2-propoxyethyl)propanamide |
| SMILES | CCCCCC(CCC)C1CC(=O)N(c2ccc(CCC(=O)NCCOCCC)cc2)C1=O |
| InChI | InChI=1S/C27H42N2O4/c1-4-7-8-10-22(9-5-2)24-20-26(31)29(27(24)32)23-14-11-21(12-15-23)13-16-25(30)28-17-19-33-18-6-3/h11-12,14-15,22,24H,4-10,13,16-20H2,1-3H3,(H,28,30) |
| InChIKey | SYZNDGUEIMETDZ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.64 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|