About 3-[4-(3-nonan-4-yl-2,5-dioxopyrrolidin-1-yl)phenyl]-N-(2-propoxyethyl)propanamide
3-[4-(3-nonan-4-yl-2,5-dioxopyrrolidin-1-yl)phenyl]-N-(2-propoxyethyl)propanamide (PubChem CID 121323600) has the molecular formula C27H42N2O4
and a molecular weight of 458.64 g/mol. Its IUPAC name is 3-[4-(3-nonan-4-yl-2,5-dioxopyrrolidin-1-yl)phenyl]-N-(2-propoxyethyl)propanamide.
Molecular Properties
| Compound Name | 3-[4-(3-nonan-4-yl-2,5-dioxopyrrolidin-1-yl)phenyl]-N-(2-propoxyethyl)propanamide |
| PubChem CID | 121323600 |
| Molecular Formula | C27H42N2O4 |
| Molecular Weight | 458.64 g/mol |
| Exact Mass | 458.31 |
| IUPAC Name | 3-[4-(3-nonan-4-yl-2,5-dioxopyrrolidin-1-yl)phenyl]-N-(2-propoxyethyl)propanamide |
| SMILES | CCCCCC(CCC)C1CC(=O)N(c2ccc(CCC(=O)NCCOCCC)cc2)C1=O |
| InChI | InChI=1S/C27H42N2O4/c1-4-7-8-10-22(9-5-2)24-20-26(31)29(27(24)32)23-14-11-21(12-15-23)13-16-25(30)28-17-19-33-18-6-3/h11-12,14-15,22,24H,4-10,13,16-20H2,1-3H3,(H,28,30) |
| InChIKey | SYZNDGUEIMETDZ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 458.64 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-(3-nonan-4-yl-2,5-dioxopyrrolidin-1-yl)phenyl]-N-(2-propoxyethyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(3-nonan-4-yl-2,5-dioxopyrrolidin-1-yl)phenyl]-N-(2-propoxyethyl)propanamide?
The IUPAC name of 3-[4-(3-nonan-4-yl-2,5-dioxopyrrolidin-1-yl)phenyl]-N-(2-propoxyethyl)propanamide (CID 121323600) is 3-[4-(3-nonan-4-yl-2,5-dioxopyrrolidin-1-yl)phenyl]-N-(2-propoxyethyl)propanamide.
What is the SMILES notation for 3-[4-(3-nonan-4-yl-2,5-dioxopyrrolidin-1-yl)phenyl]-N-(2-propoxyethyl)propanamide?
The canonical SMILES for 3-[4-(3-nonan-4-yl-2,5-dioxopyrrolidin-1-yl)phenyl]-N-(2-propoxyethyl)propanamide is CCCCCC(CCC)C1CC(=O)N(c2ccc(CCC(=O)NCCOCCC)cc2)C1=O.
What is the InChIKey of 3-[4-(3-nonan-4-yl-2,5-dioxopyrrolidin-1-yl)phenyl]-N-(2-propoxyethyl)propanamide?
The InChIKey is SYZNDGUEIMETDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H42N2O4/c1-4-7-8-10-22(9-5-2)24-20-26(31)29(27(24)32)23-14-11-21(12-15-23)13-16-25(30)28-17-19-33-18-6-3/h11-12,14-15,22,24H,4-10,13,16-20H2,1-3H3,(H,28,30).
What are the key properties of 3-[4-(3-nonan-4-yl-2,5-dioxopyrrolidin-1-yl)phenyl]-N-(2-propoxyethyl)propanamide?
3-[4-(3-nonan-4-yl-2,5-dioxopyrrolidin-1-yl)phenyl]-N-(2-propoxyethyl)propanamide has a molecular weight of 458.64 g/mol, XLogP of 5.04, 16 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(3-nonan-4-yl-2,5-dioxopyrrolidin-1-yl)phenyl]-N-(2-propoxyethyl)propanamide is sourced from PubChem (CID 121323600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).