C23H37NO2 — CID 163496658
3-methyl-1-(4-propylphenyl)pyrrolidine-2,5-dione;nonane (PubChem CID 163496658) has the molecular formula C23H37NO2 and a molecular weight of 359.55 g/mol. Its IUPAC name is 3-methyl-1-(4-propylphenyl)pyrrolidine-2,5-dione;nonane.
| Compound Name | 3-methyl-1-(4-propylphenyl)pyrrolidine-2,5-dione;nonane |
|---|---|
| PubChem CID | 163496658 |
| Molecular Formula | C23H37NO2 |
| Molecular Weight | 359.55 g/mol |
| Exact Mass | 359.28 |
| IUPAC Name | 3-methyl-1-(4-propylphenyl)pyrrolidine-2,5-dione;nonane |
| SMILES | CCCCCCCCC.CCCc1ccc(N2C(=O)CC(C)C2=O)cc1 |
| InChI | InChI=1S/C14H17NO2.C9H20/c1-3-4-11-5-7-12(8-6-11)15-13(16)9-10(2)14(15)17;1-3-5-7-9-8-6-4-2/h5-8,10H,3-4,9H2,1-2H3;3-9H2,1-2H3 |
| InChIKey | CRHPOVGSBKAGCV-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.55 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|