C30H36N6O8S — CID 170751652
2-[[2-[[2-[3-[4-(2,5-dioxo-3-sulfanylpyrrolidin-1-yl)phenyl]propanoylamino]acetyl]amino]acetyl]amino]-N-[2-(methoxymethylamino)-2-oxoethyl]-3-phenylpropanamide (PubChem CID 170751652) has the molecular formula C30H36N6O8S and a molecular weight of 640.72 g/mol. Its IUPAC name is 2-[[2-[[2-[3-[4-(2,5-dioxo-3-sulfanylpyrrolidin-1-yl)phenyl]propanoylamino]acetyl]amino]acetyl]amino]-N-[2-(methoxymethylamino)-2-oxoethyl]-3-phenylpropanamide.
| Compound Name | 2-[[2-[[2-[3-[4-(2,5-dioxo-3-sulfanylpyrrolidin-1-yl)phenyl]propanoylamino]acetyl]amino]acetyl]amino]-N-[2-(methoxymethylamino)-2-oxoethyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 170751652 |
| Molecular Formula | C30H36N6O8S |
| Molecular Weight | 640.72 g/mol |
| Exact Mass | 640.23 |
| IUPAC Name | 2-[[2-[[2-[3-[4-(2,5-dioxo-3-sulfanylpyrrolidin-1-yl)phenyl]propanoylamino]acetyl]amino]acetyl]amino]-N-[2-(methoxymethylamino)-2-oxoethyl]-3-phenylpropanamide |
| SMILES | COCNC(=O)CNC(=O)C(Cc1ccccc1)NC(=O)CNC(=O)CNC(=O)CCc1ccc(N2C(=O)CC(S)C2=O)cc1 |
| InChI | InChI=1S/C30H36N6O8S/c1-44-18-34-26(39)16-33-29(42)22(13-20-5-3-2-4-6-20)35-27(40)17-32-25(38)15-31-24(37)12-9-19-7-10-21(11-8-19)36-28(41)14-23(45)30(36)43/h2-8,10-11,22-23,45H,9,12-18H2,1H3,(H,31,37)(H,32,38)(H,33,42)(H,34,39)(H,35,40) |
| InChIKey | GTYZGMYIZABDAP-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 192.11 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.72 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|