C19H21IN2O5 — CID 157473862
3-[3-[3-[4-(2,5-dioxopyrrol-1-yl)phenyl]propanoylamino]propoxy]propanoyl iodide (PubChem CID 157473862) has the molecular formula C19H21IN2O5 and a molecular weight of 484.29 g/mol. Its IUPAC name is 3-[3-[3-[4-(2,5-dioxopyrrol-1-yl)phenyl]propanoylamino]propoxy]propanoyl iodide.
| Compound Name | 3-[3-[3-[4-(2,5-dioxopyrrol-1-yl)phenyl]propanoylamino]propoxy]propanoyl iodide |
|---|---|
| PubChem CID | 157473862 |
| Molecular Formula | C19H21IN2O5 |
| Molecular Weight | 484.29 g/mol |
| Exact Mass | 484.05 |
| IUPAC Name | 3-[3-[3-[4-(2,5-dioxopyrrol-1-yl)phenyl]propanoylamino]propoxy]propanoyl iodide |
| SMILES | O=C(I)CCOCCCNC(=O)CCc1ccc(N2C(=O)C=CC2=O)cc1 |
| InChI | InChI=1S/C19H21IN2O5/c20-16(23)10-13-27-12-1-11-21-17(24)7-4-14-2-5-15(6-3-14)22-18(25)8-9-19(22)26/h2-3,5-6,8-9H,1,4,7,10-13H2,(H,21,24) |
| InChIKey | BVIUDPUWKXHILR-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.29 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|