C29H38N4O7S — CID 164967965
N-[2-[2-[5-[4-(2,5-dioxopyrrol-1-yl)phenyl]-4-oxopentoxy]ethoxy]ethyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide (PubChem CID 164967965) has the molecular formula C29H38N4O7S and a molecular weight of 586.71 g/mol. Its IUPAC name is N-[2-[2-[5-[4-(2,5-dioxopyrrol-1-yl)phenyl]-4-oxopentoxy]ethoxy]ethyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide.
| Compound Name | N-[2-[2-[5-[4-(2,5-dioxopyrrol-1-yl)phenyl]-4-oxopentoxy]ethoxy]ethyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide |
|---|---|
| PubChem CID | 164967965 |
| Molecular Formula | C29H38N4O7S |
| Molecular Weight | 586.71 g/mol |
| Exact Mass | 586.25 |
| IUPAC Name | N-[2-[2-[5-[4-(2,5-dioxopyrrol-1-yl)phenyl]-4-oxopentoxy]ethoxy]ethyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide |
| SMILES | O=C(CCCOCCOCCNC(=O)CCCCC1SCC2NC(=O)NC21)Cc1ccc(N2C(=O)C=CC2=O)cc1 |
| InChI | InChI=1S/C29H38N4O7S/c34-22(18-20-7-9-21(10-8-20)33-26(36)11-12-27(33)37)4-3-14-39-16-17-40-15-13-30-25(35)6-2-1-5-24-28-23(19-41-24)31-29(38)32-28/h7-12,23-24,28H,1-6,13-19H2,(H,30,35)(H2,31,32,38) |
| InChIKey | KIGPOVGNSXPOCF-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 143.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.71 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|