C25H38N2O3 — CID 135218138
3-[4-(2,5-dioxo-3-propan-2-ylpyrrolidin-1-yl)phenyl]-3-methyl-N-(5-methylhexan-2-yl)butanamide (PubChem CID 135218138) has the molecular formula C25H38N2O3 and a molecular weight of 414.59 g/mol. Its IUPAC name is 3-[4-(2,5-dioxo-3-propan-2-ylpyrrolidin-1-yl)phenyl]-3-methyl-N-(5-methylhexan-2-yl)butanamide.
| Compound Name | 3-[4-(2,5-dioxo-3-propan-2-ylpyrrolidin-1-yl)phenyl]-3-methyl-N-(5-methylhexan-2-yl)butanamide |
|---|---|
| PubChem CID | 135218138 |
| Molecular Formula | C25H38N2O3 |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.29 |
| IUPAC Name | 3-[4-(2,5-dioxo-3-propan-2-ylpyrrolidin-1-yl)phenyl]-3-methyl-N-(5-methylhexan-2-yl)butanamide |
| SMILES | CC(C)CCC(C)NC(=O)CC(C)(C)c1ccc(N2C(=O)CC(C(C)C)C2=O)cc1 |
| InChI | InChI=1S/C25H38N2O3/c1-16(2)8-9-18(5)26-22(28)15-25(6,7)19-10-12-20(13-11-19)27-23(29)14-21(17(3)4)24(27)30/h10-13,16-18,21H,8-9,14-15H2,1-7H3,(H,26,28) |
| InChIKey | ZNTZADBBYXGXNT-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|