C31H36N3O3P — CID 134272260
1-[2,6-di(propan-2-yl)phenyl]-3-(2-oxo-1,3-diphenyl-1,3,2λ5-diazaphosphinan-2-yl)pyrrolidine-2,5-dione (PubChem CID 134272260) has the molecular formula C31H36N3O3P and a molecular weight of 529.62 g/mol. Its IUPAC name is 1-[2,6-di(propan-2-yl)phenyl]-3-(2-oxo-1,3-diphenyl-1,3,2λ5-diazaphosphinan-2-yl)pyrrolidine-2,5-dione.
| Compound Name | 1-[2,6-di(propan-2-yl)phenyl]-3-(2-oxo-1,3-diphenyl-1,3,2λ5-diazaphosphinan-2-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 134272260 |
| Molecular Formula | C31H36N3O3P |
| Molecular Weight | 529.62 g/mol |
| Exact Mass | 529.25 |
| IUPAC Name | 1-[2,6-di(propan-2-yl)phenyl]-3-(2-oxo-1,3-diphenyl-1,3,2λ5-diazaphosphinan-2-yl)pyrrolidine-2,5-dione |
| SMILES | CC(C)c1cccc(C(C)C)c1N1C(=O)CC(P2(=O)N(c3ccccc3)CCCN2c2ccccc2)C1=O |
| InChI | InChI=1S/C31H36N3O3P/c1-22(2)26-17-11-18-27(23(3)4)30(26)34-29(35)21-28(31(34)36)38(37)32(24-13-7-5-8-14-24)19-12-20-33(38)25-15-9-6-10-16-25/h5-11,13-18,22-23,28H,12,19-21H2,1-4H3 |
| InChIKey | LNGITYPAKJRJBS-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.62 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|