C25H26N3O3P — CID 134274772
5-hydroxy-1-(4-methylphenyl)-3-(2-oxo-1,3-diphenyl-1,3,2λ5-diazaphospholidin-2-yl)pyrrolidin-2-one (PubChem CID 134274772) has the molecular formula C25H26N3O3P and a molecular weight of 447.48 g/mol. Its IUPAC name is 5-hydroxy-1-(4-methylphenyl)-3-(2-oxo-1,3-diphenyl-1,3,2λ5-diazaphospholidin-2-yl)pyrrolidin-2-one.
| Compound Name | 5-hydroxy-1-(4-methylphenyl)-3-(2-oxo-1,3-diphenyl-1,3,2λ5-diazaphospholidin-2-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 134274772 |
| Molecular Formula | C25H26N3O3P |
| Molecular Weight | 447.48 g/mol |
| Exact Mass | 447.17 |
| IUPAC Name | 5-hydroxy-1-(4-methylphenyl)-3-(2-oxo-1,3-diphenyl-1,3,2λ5-diazaphospholidin-2-yl)pyrrolidin-2-one |
| SMILES | Cc1ccc(N2C(=O)C(P3(=O)N(c4ccccc4)CCN3c3ccccc3)CC2O)cc1 |
| InChI | InChI=1S/C25H26N3O3P/c1-19-12-14-22(15-13-19)28-24(29)18-23(25(28)30)32(31)26(20-8-4-2-5-9-20)16-17-27(32)21-10-6-3-7-11-21/h2-15,23-24,29H,16-18H2,1H3 |
| InChIKey | WDDMLWWFDCFJNA-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.48 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|