C18H14Cl2N2O4 — CID 88752845
N-[1-(3,5-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-phenylmethoxyformamide (PubChem CID 88752845) has the molecular formula C18H14Cl2N2O4 and a molecular weight of 393.23 g/mol. Its IUPAC name is N-[1-(3,5-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-phenylmethoxyformamide.
| Compound Name | N-[1-(3,5-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-phenylmethoxyformamide |
|---|---|
| PubChem CID | 88752845 |
| Molecular Formula | C18H14Cl2N2O4 |
| Molecular Weight | 393.23 g/mol |
| Exact Mass | 392.03 |
| IUPAC Name | N-[1-(3,5-dichlorophenyl)-2,5-dioxopyrrolidin-3-yl]-N-phenylmethoxyformamide |
| SMILES | O=CN(OCc1ccccc1)C1CC(=O)N(c2cc(Cl)cc(Cl)c2)C1=O |
| InChI | InChI=1S/C18H14Cl2N2O4/c19-13-6-14(20)8-15(7-13)22-17(24)9-16(18(22)25)21(11-23)26-10-12-4-2-1-3-5-12/h1-8,11,16H,9-10H2 |
| InChIKey | CJXDRDOKUOBTJY-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.23 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|