C19H16Cl2N2O2 — CID 2000820
(3R)-1-(3,5-dichlorophenyl)-3-(3,4-dihydro-1H-isoquinolin-2-yl)pyrrolidine-2,5-dione (PubChem CID 2000820) has the molecular formula C19H16Cl2N2O2 and a molecular weight of 375.26 g/mol. Its IUPAC name is (3R)-1-(3,5-dichlorophenyl)-3-(3,4-dihydro-1H-isoquinolin-2-yl)pyrrolidine-2,5-dione.
| Compound Name | (3R)-1-(3,5-dichlorophenyl)-3-(3,4-dihydro-1H-isoquinolin-2-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 2000820 |
| Molecular Formula | C19H16Cl2N2O2 |
| Molecular Weight | 375.26 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | (3R)-1-(3,5-dichlorophenyl)-3-(3,4-dihydro-1H-isoquinolin-2-yl)pyrrolidine-2,5-dione |
| SMILES | O=C1C[C@@H](N2CCc3ccccc3C2)C(=O)N1c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C19H16Cl2N2O2/c20-14-7-15(21)9-16(8-14)23-18(24)10-17(19(23)25)22-6-5-12-3-1-2-4-13(12)11-22/h1-4,7-9,17H,5-6,10-11H2/t17-/m1/s1 |
| InChIKey | ZIBKRYHCMALQLS-QGZVFWFLSA-N |
| XLogP | 3.68 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.26 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|