C12H13ClN2O3S — CID 80520374
9-chloro-3,3-dioxo-1,2,4,4a,5,7-hexahydro-[1,4]thiazino[4,3-a][1,5]benzodiazepin-6-one (PubChem CID 80520374) has the molecular formula C12H13ClN2O3S and a molecular weight of 300.77 g/mol. Its IUPAC name is 9-chloro-3,3-dioxo-1,2,4,4a,5,7-hexahydro-[1,4]thiazino[4,3-a][1,5]benzodiazepin-6-one.
| Compound Name | 9-chloro-3,3-dioxo-1,2,4,4a,5,7-hexahydro-[1,4]thiazino[4,3-a][1,5]benzodiazepin-6-one |
|---|---|
| PubChem CID | 80520374 |
| Molecular Formula | C12H13ClN2O3S |
| Molecular Weight | 300.77 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | 9-chloro-3,3-dioxo-1,2,4,4a,5,7-hexahydro-[1,4]thiazino[4,3-a][1,5]benzodiazepin-6-one |
| SMILES | O=C1CC2CS(=O)(=O)CCN2c2ccc(Cl)cc2N1 |
| InChI | InChI=1S/C12H13ClN2O3S/c13-8-1-2-11-10(5-8)14-12(16)6-9-7-19(17,18)4-3-15(9)11/h1-2,5,9H,3-4,6-7H2,(H,14,16) |
| InChIKey | NBKUZIVCOCSTEQ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.77 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |