C31H38N6O4S — CID 135960694
2-[1-(5-carbamimidoyl-2-hydroxyphenyl)piperazin-2-yl]-2-cyclohexyl-N-[4-(2-sulfamoylphenyl)phenyl]acetamide (PubChem CID 135960694) has the molecular formula C31H38N6O4S and a molecular weight of 590.75 g/mol. Its IUPAC name is 2-[1-(5-carbamimidoyl-2-hydroxyphenyl)piperazin-2-yl]-2-cyclohexyl-N-[4-(2-sulfamoylphenyl)phenyl]acetamide.
| Compound Name | 2-[1-(5-carbamimidoyl-2-hydroxyphenyl)piperazin-2-yl]-2-cyclohexyl-N-[4-(2-sulfamoylphenyl)phenyl]acetamide |
|---|---|
| PubChem CID | 135960694 |
| Molecular Formula | C31H38N6O4S |
| Molecular Weight | 590.75 g/mol |
| Exact Mass | 590.27 |
| IUPAC Name | 2-[1-(5-carbamimidoyl-2-hydroxyphenyl)piperazin-2-yl]-2-cyclohexyl-N-[4-(2-sulfamoylphenyl)phenyl]acetamide |
| SMILES | [H]/N=C(\N)c1ccc(O)c(N2CCNCC2C(C(=O)Nc2ccc(-c3ccccc3S(N)(=O)=O)cc2)C2CCCCC2)c1 |
| InChI | InChI=1S/C31H38N6O4S/c32-30(33)22-12-15-27(38)25(18-22)37-17-16-35-19-26(37)29(21-6-2-1-3-7-21)31(39)36-23-13-10-20(11-14-23)24-8-4-5-9-28(24)42(34,40)41/h4-5,8-15,18,21,26,29,35,38H,1-3,6-7,16-17,19H2,(H3,32,33)(H,36,39)(H2,34,40,41) |
| InChIKey | NCFKJVVCTABRIA-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 174.63 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.75 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|