C31H34N6O2S — CID 142029725
3-[6-phenyl-2-[[4-(2-sulfamoylphenyl)anilino]methyl]-1,4-diazepan-1-yl]benzenecarboximidamide (PubChem CID 142029725) has the molecular formula C31H34N6O2S and a molecular weight of 554.72 g/mol. Its IUPAC name is 3-[6-phenyl-2-[[4-(2-sulfamoylphenyl)anilino]methyl]-1,4-diazepan-1-yl]benzenecarboximidamide.
| Compound Name | 3-[6-phenyl-2-[[4-(2-sulfamoylphenyl)anilino]methyl]-1,4-diazepan-1-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 142029725 |
| Molecular Formula | C31H34N6O2S |
| Molecular Weight | 554.72 g/mol |
| Exact Mass | 554.25 |
| IUPAC Name | 3-[6-phenyl-2-[[4-(2-sulfamoylphenyl)anilino]methyl]-1,4-diazepan-1-yl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(N2CC(c3ccccc3)CNCC2CNc2ccc(-c3ccccc3S(N)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C31H34N6O2S/c32-31(33)24-9-6-10-27(17-24)37-21-25(22-7-2-1-3-8-22)18-35-19-28(37)20-36-26-15-13-23(14-16-26)29-11-4-5-12-30(29)40(34,38)39/h1-17,25,28,35-36H,18-21H2,(H3,32,33)(H2,34,38,39) |
| InChIKey | VGVQOTVFCHVTPM-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 137.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.72 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|