C14H16N2O2 — CID 165342590
3-methyl-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepine-6,12-dione (PubChem CID 165342590) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is 3-methyl-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepine-6,12-dione.
| Compound Name | 3-methyl-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepine-6,12-dione |
|---|---|
| PubChem CID | 165342590 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 3-methyl-5,6a,7,8,9,10-hexahydropyrido[2,1-c][1,4]benzodiazepine-6,12-dione |
| SMILES | Cc1ccc2c(c1)NC(=O)C1CCCCN1C2=O |
| InChI | InChI=1S/C14H16N2O2/c1-9-5-6-10-11(8-9)15-13(17)12-4-2-3-7-16(12)14(10)18/h5-6,8,12H,2-4,7H2,1H3,(H,15,17) |
| InChIKey | DERZHRREWXYBNA-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |