C11H16N4O3 — CID 10399945
3-hexyl-7,9-dihydropurine-2,6,8-trione (PubChem CID 10399945) has the molecular formula C11H16N4O3 and a molecular weight of 252.27 g/mol. Its IUPAC name is 3-hexyl-7,9-dihydropurine-2,6,8-trione.
| Compound Name | 3-hexyl-7,9-dihydropurine-2,6,8-trione |
|---|---|
| PubChem CID | 10399945 |
| Molecular Formula | C11H16N4O3 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 3-hexyl-7,9-dihydropurine-2,6,8-trione |
| SMILES | CCCCCCn1c(=O)[nH]c(=O)c2[nH]c(=O)[nH]c21 |
| InChI | InChI=1S/C11H16N4O3/c1-2-3-4-5-6-15-8-7(12-10(17)13-8)9(16)14-11(15)18/h2-6H2,1H3,(H2,12,13,17)(H,14,16,18) |
| InChIKey | FTICHEOMXFPIIN-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 103.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|