C16H19N3O — CID 103999480
3-cyclohexyl-5-(2,3-dihydro-1H-isoindol-5-yl)-1,2,4-oxadiazole (PubChem CID 103999480) has the molecular formula C16H19N3O and a molecular weight of 269.35 g/mol. Its IUPAC name is 3-cyclohexyl-5-(2,3-dihydro-1H-isoindol-5-yl)-1,2,4-oxadiazole.
| Compound Name | 3-cyclohexyl-5-(2,3-dihydro-1H-isoindol-5-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 103999480 |
| Molecular Formula | C16H19N3O |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 3-cyclohexyl-5-(2,3-dihydro-1H-isoindol-5-yl)-1,2,4-oxadiazole |
| SMILES | c1cc2c(cc1-c1nc(C3CCCCC3)no1)CNC2 |
| InChI | InChI=1S/C16H19N3O/c1-2-4-11(5-3-1)15-18-16(20-19-15)12-6-7-13-9-17-10-14(13)8-12/h6-8,11,17H,1-5,9-10H2 |
| InChIKey | WGXILCHNZPFMPS-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |