2-propan-2-yloxyethyl 2,3-dihydro-1H-isoindole-5-carboxylate

C14H19NO3 — CID 103999601

IUPAC2-propan-2-yloxyethyl 2,3-dihydro-1H-isoindole-5-carboxylate
SMILESCC(C)OCCOC(=O)c1ccc2c(c1)CNC2
InChIInChI=1S/C14H19NO3/c1-10(2)17-5-6-18-14(16)11-3-4-12-8-15-9-13(12)7-11/h3-4,7,10,15H,5-6,8-9H2,1-2H3
InChIKeyNGMRCQQJSYUQDW-UHFFFAOYSA-N
MW249.31 g/mol
LogP1.87
Rot. Bonds5

About 2-propan-2-yloxyethyl 2,3-dihydro-1H-isoindole-5-carboxylate

2-propan-2-yloxyethyl 2,3-dihydro-1H-isoindole-5-carboxylate (PubChem CID 103999601) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is 2-propan-2-yloxyethyl 2,3-dihydro-1H-isoindole-5-carboxylate.

Molecular Properties

Compound Name2-propan-2-yloxyethyl 2,3-dihydro-1H-isoindole-5-carboxylate
PubChem CID103999601
Molecular FormulaC14H19NO3
Molecular Weight249.31 g/mol
Exact Mass249.14
IUPAC Name2-propan-2-yloxyethyl 2,3-dihydro-1H-isoindole-5-carboxylate
SMILESCC(C)OCCOC(=O)c1ccc2c(c1)CNC2
InChIInChI=1S/C14H19NO3/c1-10(2)17-5-6-18-14(16)11-3-4-12-8-15-9-13(12)7-11/h3-4,7,10,15H,5-6,8-9H2,1-2H3
InChIKeyNGMRCQQJSYUQDW-UHFFFAOYSA-N
XLogP1.87
TPSA47.56 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500249.31
LogP ≤ 51.87
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-propan-2-yloxyethyl 2,3-dihydro-1H-isoindole-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-propan-2-yloxyethyl 2,3-dihydro-1H-isoindole-5-carboxylate?
The IUPAC name of 2-propan-2-yloxyethyl 2,3-dihydro-1H-isoindole-5-carboxylate (CID 103999601) is 2-propan-2-yloxyethyl 2,3-dihydro-1H-isoindole-5-carboxylate.
What is the SMILES notation for 2-propan-2-yloxyethyl 2,3-dihydro-1H-isoindole-5-carboxylate?
The canonical SMILES for 2-propan-2-yloxyethyl 2,3-dihydro-1H-isoindole-5-carboxylate is CC(C)OCCOC(=O)c1ccc2c(c1)CNC2.
What is the InChIKey of 2-propan-2-yloxyethyl 2,3-dihydro-1H-isoindole-5-carboxylate?
The InChIKey is NGMRCQQJSYUQDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO3/c1-10(2)17-5-6-18-14(16)11-3-4-12-8-15-9-13(12)7-11/h3-4,7,10,15H,5-6,8-9H2,1-2H3.
What are the key properties of 2-propan-2-yloxyethyl 2,3-dihydro-1H-isoindole-5-carboxylate?
2-propan-2-yloxyethyl 2,3-dihydro-1H-isoindole-5-carboxylate has a molecular weight of 249.31 g/mol, XLogP of 1.87, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yloxyethyl 2,3-dihydro-1H-isoindole-5-carboxylate is sourced from PubChem (CID 103999601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).