C15H24N2O4 — CID 10402316
tert-butyl 3-oxo-2-prop-2-enyl-1-oxa-2,8-diazaspiro[4.5]decane-8-carboxylate (PubChem CID 10402316) has the molecular formula C15H24N2O4 and a molecular weight of 296.37 g/mol. Its IUPAC name is tert-butyl 3-oxo-2-prop-2-enyl-1-oxa-2,8-diazaspiro[4.5]decane-8-carboxylate.
| Compound Name | tert-butyl 3-oxo-2-prop-2-enyl-1-oxa-2,8-diazaspiro[4.5]decane-8-carboxylate |
|---|---|
| PubChem CID | 10402316 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | tert-butyl 3-oxo-2-prop-2-enyl-1-oxa-2,8-diazaspiro[4.5]decane-8-carboxylate |
| SMILES | C=CCN1OC2(CCN(C(=O)OC(C)(C)C)CC2)CC1=O |
| InChI | InChI=1S/C15H24N2O4/c1-5-8-17-12(18)11-15(21-17)6-9-16(10-7-15)13(19)20-14(2,3)4/h5H,1,6-11H2,2-4H3 |
| InChIKey | NWZOCLZECBEGOC-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|