C20H44N2 — CID 10403265
1-N,1-N-diethylhexadecane-1,2-diamine (PubChem CID 10403265) has the molecular formula C20H44N2 and a molecular weight of 312.59 g/mol. Its IUPAC name is 1-N,1-N-diethylhexadecane-1,2-diamine.
| Compound Name | 1-N,1-N-diethylhexadecane-1,2-diamine |
|---|---|
| PubChem CID | 10403265 |
| Molecular Formula | C20H44N2 |
| Molecular Weight | 312.59 g/mol |
| Exact Mass | 312.35 |
| IUPAC Name | 1-N,1-N-diethylhexadecane-1,2-diamine |
| SMILES | CCCCCCCCCCCCCCC(N)CN(CC)CC |
| InChI | InChI=1S/C20H44N2/c1-4-7-8-9-10-11-12-13-14-15-16-17-18-20(21)19-22(5-2)6-3/h20H,4-19,21H2,1-3H3 |
| InChIKey | UOERQNNPROAOGM-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.59 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|