C20H30O3 — CID 10403612
2-[(E)-3-[(2S,5R)-5-hex-5-ynyl-4-methyl-2,5-dihydrofuran-2-yl]-2-methylprop-2-enoxy]oxane (PubChem CID 10403612) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is 2-[(E)-3-[(2S,5R)-5-hex-5-ynyl-4-methyl-2,5-dihydrofuran-2-yl]-2-methylprop-2-enoxy]oxane.
| Compound Name | 2-[(E)-3-[(2S,5R)-5-hex-5-ynyl-4-methyl-2,5-dihydrofuran-2-yl]-2-methylprop-2-enoxy]oxane |
|---|---|
| PubChem CID | 10403612 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | 2-[(E)-3-[(2S,5R)-5-hex-5-ynyl-4-methyl-2,5-dihydrofuran-2-yl]-2-methylprop-2-enoxy]oxane |
| SMILES | C#CCCCC[C@H]1O[C@@H](/C=C(\C)COC2CCCCO2)C=C1C |
| InChI | InChI=1S/C20H30O3/c1-4-5-6-7-10-19-17(3)14-18(23-19)13-16(2)15-22-20-11-8-9-12-21-20/h1,13-14,18-20H,5-12,15H2,2-3H3/b16-13+/t18-,19+,20?/m0/s1 |
| InChIKey | NIWJVABWSXPHDC-MIDAMXEWSA-N |
| XLogP | 4.38 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|