C21H30O3 — CID 10404396
(E,2R,3R,6S)-3,6,7-trimethyl-7-phenylmethoxy-2-prop-1-en-2-yloct-4-enoic acid (PubChem CID 10404396) has the molecular formula C21H30O3 and a molecular weight of 330.47 g/mol. Its IUPAC name is (E,2R,3R,6S)-3,6,7-trimethyl-7-phenylmethoxy-2-prop-1-en-2-yloct-4-enoic acid.
| Compound Name | (E,2R,3R,6S)-3,6,7-trimethyl-7-phenylmethoxy-2-prop-1-en-2-yloct-4-enoic acid |
|---|---|
| PubChem CID | 10404396 |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | (E,2R,3R,6S)-3,6,7-trimethyl-7-phenylmethoxy-2-prop-1-en-2-yloct-4-enoic acid |
| SMILES | C=C(C)[C@H](C(=O)O)[C@H](C)/C=C/[C@H](C)C(C)(C)OCc1ccccc1 |
| InChI | InChI=1S/C21H30O3/c1-15(2)19(20(22)23)16(3)12-13-17(4)21(5,6)24-14-18-10-8-7-9-11-18/h7-13,16-17,19H,1,14H2,2-6H3,(H,22,23)/b13-12+/t16-,17+,19+/m1/s1 |
| InChIKey | MEDIGAQFJSMBKR-ZJQDKUFWSA-N |
| XLogP | 5.09 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|