C16H23Cl2N3O-2 — CID 10405208
4-(but-3-enylamino)-N-pyridin-3-ylcyclohexane-1-carboxamide dichloride (PubChem CID 10405208) has the molecular formula C16H23Cl2N3O-2 and a molecular weight of 344.29 g/mol. Its IUPAC name is 4-(but-3-enylamino)-N-pyridin-3-ylcyclohexane-1-carboxamide dichloride.
| Compound Name | 4-(but-3-enylamino)-N-pyridin-3-ylcyclohexane-1-carboxamide dichloride |
|---|---|
| PubChem CID | 10405208 |
| Molecular Formula | C16H23Cl2N3O-2 |
| Molecular Weight | 344.29 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 4-(but-3-enylamino)-N-pyridin-3-ylcyclohexane-1-carboxamide dichloride |
| SMILES | C=CCCNC1CCC(C(=O)Nc2cccnc2)CC1.[Cl-].[Cl-] |
| InChI | InChI=1S/C16H23N3O.2ClH/c1-2-3-11-18-14-8-6-13(7-9-14)16(20)19-15-5-4-10-17-12-15;;/h2,4-5,10,12-14,18H,1,3,6-9,11H2,(H,19,20);2*1H/p-2 |
| InChIKey | UCXZASRHBRIDIW-UHFFFAOYSA-L |
| XLogP | -3.25 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.29 |
| LogP ≤ 5 | -3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|