C16H13ClN8O2 — CID 10407709
N-[[5-chloro-2-(tetrazol-1-yl)phenyl]methyl]-2-(3-cyano-1-hydroxy-6-imino-2-pyridinyl)acetamide (PubChem CID 10407709) has the molecular formula C16H13ClN8O2 and a molecular weight of 384.79 g/mol. Its IUPAC name is N-[[5-chloro-2-(tetrazol-1-yl)phenyl]methyl]-2-(3-cyano-1-hydroxy-6-imino-2-pyridinyl)acetamide.
| Compound Name | N-[[5-chloro-2-(tetrazol-1-yl)phenyl]methyl]-2-(3-cyano-1-hydroxy-6-imino-2-pyridinyl)acetamide |
|---|---|
| PubChem CID | 10407709 |
| Molecular Formula | C16H13ClN8O2 |
| Molecular Weight | 384.79 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | N-[[5-chloro-2-(tetrazol-1-yl)phenyl]methyl]-2-(3-cyano-1-hydroxy-6-imino-2-pyridinyl)acetamide |
| SMILES | [H]/N=c1\ccc(C#N)c(CC(=O)NCc2cc(Cl)ccc2-n2cnnn2)n1O |
| InChI | InChI=1S/C16H13ClN8O2/c17-12-2-3-13(24-9-21-22-23-24)11(5-12)8-20-16(26)6-14-10(7-18)1-4-15(19)25(14)27/h1-5,9,19,27H,6,8H2,(H,20,26)/b19-15+ |
| InChIKey | BHFAWBRYBISYAT-XDJHFCHBSA-N |
| XLogP | 0.56 |
| TPSA | 145.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.79 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|