C16H16N2O6S2 — CID 10408435
2-[4-[2-[(4-nitrophenyl)sulfonylamino]ethylsulfanyl]phenyl]acetic acid (PubChem CID 10408435) has the molecular formula C16H16N2O6S2 and a molecular weight of 396.45 g/mol. Its IUPAC name is 2-[4-[2-[(4-nitrophenyl)sulfonylamino]ethylsulfanyl]phenyl]acetic acid.
| Compound Name | 2-[4-[2-[(4-nitrophenyl)sulfonylamino]ethylsulfanyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 10408435 |
| Molecular Formula | C16H16N2O6S2 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | 2-[4-[2-[(4-nitrophenyl)sulfonylamino]ethylsulfanyl]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(SCCNS(=O)(=O)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C16H16N2O6S2/c19-16(20)11-12-1-5-14(6-2-12)25-10-9-17-26(23,24)15-7-3-13(4-8-15)18(21)22/h1-8,17H,9-11H2,(H,19,20) |
| InChIKey | GAKMCEAPAAPESH-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 126.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|