C23H18ClNO4 — CID 1040862
[2-(4-chlorophenyl)-2-oxoethyl] (3S)-1-naphthalen-2-yl-5-oxopyrrolidine-3-carboxylate (PubChem CID 1040862) has the molecular formula C23H18ClNO4 and a molecular weight of 407.85 g/mol. Its IUPAC name is [2-(4-chlorophenyl)-2-oxoethyl] (3S)-1-naphthalen-2-yl-5-oxopyrrolidine-3-carboxylate.
| Compound Name | [2-(4-chlorophenyl)-2-oxoethyl] (3S)-1-naphthalen-2-yl-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 1040862 |
| Molecular Formula | C23H18ClNO4 |
| Molecular Weight | 407.85 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | [2-(4-chlorophenyl)-2-oxoethyl] (3S)-1-naphthalen-2-yl-5-oxopyrrolidine-3-carboxylate |
| SMILES | O=C(COC(=O)[C@H]1CC(=O)N(c2ccc3ccccc3c2)C1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H18ClNO4/c24-19-8-5-16(6-9-19)21(26)14-29-23(28)18-12-22(27)25(13-18)20-10-7-15-3-1-2-4-17(15)11-20/h1-11,18H,12-14H2/t18-/m0/s1 |
| InChIKey | JMPFOOZMRKORGX-SFHVURJKSA-N |
| XLogP | 4.27 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.85 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |