C23H24ClNO5 — CID 2924865
[2-(4-chlorophenyl)-2-oxoethyl] 1-(4-butoxyphenyl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 2924865) has the molecular formula C23H24ClNO5 and a molecular weight of 429.90 g/mol. Its IUPAC name is [2-(4-chlorophenyl)-2-oxoethyl] 1-(4-butoxyphenyl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | [2-(4-chlorophenyl)-2-oxoethyl] 1-(4-butoxyphenyl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 2924865 |
| Molecular Formula | C23H24ClNO5 |
| Molecular Weight | 429.90 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | [2-(4-chlorophenyl)-2-oxoethyl] 1-(4-butoxyphenyl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | CCCCOc1ccc(N2CC(C(=O)OCC(=O)c3ccc(Cl)cc3)CC2=O)cc1 |
| InChI | InChI=1S/C23H24ClNO5/c1-2-3-12-29-20-10-8-19(9-11-20)25-14-17(13-22(25)27)23(28)30-15-21(26)16-4-6-18(24)7-5-16/h4-11,17H,2-3,12-15H2,1H3 |
| InChIKey | IGXJJAKTNCXFPR-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.90 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|