C21H28O6S — CID 10409186
ethyl 4-[(2R,3S,6S)-3-acetyloxy-6-ethoxy-3,6-dihydro-2H-pyran-2-yl]-3-phenylsulfanylbutanoate (PubChem CID 10409186) has the molecular formula C21H28O6S and a molecular weight of 408.52 g/mol. Its IUPAC name is ethyl 4-[(2R,3S,6S)-3-acetyloxy-6-ethoxy-3,6-dihydro-2H-pyran-2-yl]-3-phenylsulfanylbutanoate.
| Compound Name | ethyl 4-[(2R,3S,6S)-3-acetyloxy-6-ethoxy-3,6-dihydro-2H-pyran-2-yl]-3-phenylsulfanylbutanoate |
|---|---|
| PubChem CID | 10409186 |
| Molecular Formula | C21H28O6S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | ethyl 4-[(2R,3S,6S)-3-acetyloxy-6-ethoxy-3,6-dihydro-2H-pyran-2-yl]-3-phenylsulfanylbutanoate |
| SMILES | CCOC(=O)CC(C[C@H]1O[C@H](OCC)C=C[C@@H]1OC(C)=O)Sc1ccccc1 |
| InChI | InChI=1S/C21H28O6S/c1-4-24-20(23)14-17(28-16-9-7-6-8-10-16)13-19-18(26-15(3)22)11-12-21(27-19)25-5-2/h6-12,17-19,21H,4-5,13-14H2,1-3H3/t17?,18-,19+,21-/m0/s1 |
| InChIKey | ZXAJWYTUBYSVBP-QYYYHEGRSA-N |
| XLogP | 3.74 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|