C23H32O4S — CID 10982344
(5R)-5-[(4R,5S)-2,2-dimethyl-5-[(E)-oct-1-enyl]-1,3-dioxolan-4-yl]-3-phenylsulfanyloxolan-2-one (PubChem CID 10982344) has the molecular formula C23H32O4S and a molecular weight of 404.57 g/mol. Its IUPAC name is (5R)-5-[(4R,5S)-2,2-dimethyl-5-[(E)-oct-1-enyl]-1,3-dioxolan-4-yl]-3-phenylsulfanyloxolan-2-one.
| Compound Name | (5R)-5-[(4R,5S)-2,2-dimethyl-5-[(E)-oct-1-enyl]-1,3-dioxolan-4-yl]-3-phenylsulfanyloxolan-2-one |
|---|---|
| PubChem CID | 10982344 |
| Molecular Formula | C23H32O4S |
| Molecular Weight | 404.57 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | (5R)-5-[(4R,5S)-2,2-dimethyl-5-[(E)-oct-1-enyl]-1,3-dioxolan-4-yl]-3-phenylsulfanyloxolan-2-one |
| SMILES | CCCCCC/C=C/[C@@H]1OC(C)(C)O[C@@H]1[C@H]1CC(Sc2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C23H32O4S/c1-4-5-6-7-8-12-15-18-21(27-23(2,3)26-18)19-16-20(22(24)25-19)28-17-13-10-9-11-14-17/h9-15,18-21H,4-8,16H2,1-3H3/b15-12+/t18-,19+,20?,21-/m0/s1 |
| InChIKey | IOEJKSFEDKWZDE-GPRVYQJDSA-N |
| XLogP | 5.51 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.57 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|