C25H32O11S — CID 10907648
methyl (2R,4S,5R,6R)-4,5-diacetyloxy-6-[(R)-acetyloxy-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2-phenylsulfanyloxane-2-carboxylate (PubChem CID 10907648) has the molecular formula C25H32O11S and a molecular weight of 540.59 g/mol. Its IUPAC name is methyl (2R,4S,5R,6R)-4,5-diacetyloxy-6-[(R)-acetyloxy-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2-phenylsulfanyloxane-2-carboxylate.
| Compound Name | methyl (2R,4S,5R,6R)-4,5-diacetyloxy-6-[(R)-acetyloxy-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2-phenylsulfanyloxane-2-carboxylate |
|---|---|
| PubChem CID | 10907648 |
| Molecular Formula | C25H32O11S |
| Molecular Weight | 540.59 g/mol |
| Exact Mass | 540.17 |
| IUPAC Name | methyl (2R,4S,5R,6R)-4,5-diacetyloxy-6-[(R)-acetyloxy-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-2-phenylsulfanyloxane-2-carboxylate |
| SMILES | COC(=O)[C@]1(Sc2ccccc2)C[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]([C@H](OC(C)=O)[C@H]2COC(C)(C)O2)O1 |
| InChI | InChI=1S/C25H32O11S/c1-14(26)32-18-12-25(23(29)30-6,37-17-10-8-7-9-11-17)36-22(20(18)33-15(2)27)21(34-16(3)28)19-13-31-24(4,5)35-19/h7-11,18-22H,12-13H2,1-6H3/t18-,19+,20+,21+,22+,25+/m0/s1 |
| InChIKey | ZGWZTLRZBNCJTP-TUTCKEIYSA-N |
| XLogP | 2.38 |
| TPSA | 132.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.59 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|