C16H16O7S — CID 126707672
[(3S,8S)-4-acetyloxy-7-oxo-3-phenylsulfanyl-2,6-dioxabicyclo[3.2.1]octan-8-yl] acetate (PubChem CID 126707672) has the molecular formula C16H16O7S and a molecular weight of 352.36 g/mol. Its IUPAC name is [(3S,8S)-4-acetyloxy-7-oxo-3-phenylsulfanyl-2,6-dioxabicyclo[3.2.1]octan-8-yl] acetate.
| Compound Name | [(3S,8S)-4-acetyloxy-7-oxo-3-phenylsulfanyl-2,6-dioxabicyclo[3.2.1]octan-8-yl] acetate |
|---|---|
| PubChem CID | 126707672 |
| Molecular Formula | C16H16O7S |
| Molecular Weight | 352.36 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | [(3S,8S)-4-acetyloxy-7-oxo-3-phenylsulfanyl-2,6-dioxabicyclo[3.2.1]octan-8-yl] acetate |
| SMILES | CC(=O)OC1C2OC(=O)C(O[C@H]1Sc1ccccc1)[C@H]2OC(C)=O |
| InChI | InChI=1S/C16H16O7S/c1-8(17)20-11-12-14(21-9(2)18)16(23-13(11)15(19)22-12)24-10-6-4-3-5-7-10/h3-7,11-14,16H,1-2H3/t11-,12?,13?,14?,16-/m0/s1 |
| InChIKey | DCJUDWATQXBTPI-QTNGLCDKSA-N |
| XLogP | 1.29 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.36 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|