C25H42O7SSi2 — CID 134877425
methyl (5aR,6S,8S,9R,9aR)-9-hydroxy-8-phenylsulfanyl-2,2,4,4-tetra(propan-2-yl)-6,8,9,9a-tetrahydro-5aH-pyrano[3,4-f][1,3,5,2,4]trioxadisilepine-6-carboxylate (PubChem CID 134877425) has the molecular formula C25H42O7SSi2 and a molecular weight of 542.84 g/mol. Its IUPAC name is methyl (5aR,6S,8S,9R,9aR)-9-hydroxy-8-phenylsulfanyl-2,2,4,4-tetra(propan-2-yl)-6,8,9,9a-tetrahydro-5aH-pyrano[3,4-f][1,3,5,2,4]trioxadisilepine-6-carboxylate.
| Compound Name | methyl (5aR,6S,8S,9R,9aR)-9-hydroxy-8-phenylsulfanyl-2,2,4,4-tetra(propan-2-yl)-6,8,9,9a-tetrahydro-5aH-pyrano[3,4-f][1,3,5,2,4]trioxadisilepine-6-carboxylate |
|---|---|
| PubChem CID | 134877425 |
| Molecular Formula | C25H42O7SSi2 |
| Molecular Weight | 542.84 g/mol |
| Exact Mass | 542.22 |
| IUPAC Name | methyl (5aR,6S,8S,9R,9aR)-9-hydroxy-8-phenylsulfanyl-2,2,4,4-tetra(propan-2-yl)-6,8,9,9a-tetrahydro-5aH-pyrano[3,4-f][1,3,5,2,4]trioxadisilepine-6-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](Sc2ccccc2)[C@H](O)[C@H]2O[Si](C(C)C)(C(C)C)O[Si](C(C)C)(C(C)C)O[C@@H]21 |
| InChI | InChI=1S/C25H42O7SSi2/c1-15(2)34(16(3)4)30-21-20(26)25(33-19-13-11-10-12-14-19)29-23(24(27)28-9)22(21)31-35(32-34,17(5)6)18(7)8/h10-18,20-23,25-26H,1-9H3/t20-,21-,22+,23+,25+/m1/s1 |
| InChIKey | YVXZJOULWNGIIG-BZDYCCQFSA-N |
| XLogP | 5.36 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.84 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|