C23H27NO4S — CID 10409503
benzyl (2S)-2-[[2-(acetylsulfanylmethyl)-3-phenylbutanoyl]amino]propanoate (PubChem CID 10409503) has the molecular formula C23H27NO4S and a molecular weight of 413.54 g/mol. Its IUPAC name is benzyl (2S)-2-[[2-(acetylsulfanylmethyl)-3-phenylbutanoyl]amino]propanoate.
| Compound Name | benzyl (2S)-2-[[2-(acetylsulfanylmethyl)-3-phenylbutanoyl]amino]propanoate |
|---|---|
| PubChem CID | 10409503 |
| Molecular Formula | C23H27NO4S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | benzyl (2S)-2-[[2-(acetylsulfanylmethyl)-3-phenylbutanoyl]amino]propanoate |
| SMILES | CC(=O)SCC(C(=O)N[C@@H](C)C(=O)OCc1ccccc1)C(C)c1ccccc1 |
| InChI | InChI=1S/C23H27NO4S/c1-16(20-12-8-5-9-13-20)21(15-29-18(3)25)22(26)24-17(2)23(27)28-14-19-10-6-4-7-11-19/h4-13,16-17,21H,14-15H2,1-3H3,(H,24,26)/t16?,17-,21?/m0/s1 |
| InChIKey | YRNMSDWCGDCPGU-BATSVXPKSA-N |
| XLogP | 3.93 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|