C26H42N2O2 — CID 10409568
N-[(1S,3aS,3bR,5aR,9aR,9bS,11aS)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-1-yl]-N-cyclohexylformamide (PubChem CID 10409568) has the molecular formula C26H42N2O2 and a molecular weight of 414.63 g/mol. Its IUPAC name is N-[(1S,3aS,3bR,5aR,9aR,9bS,11aS)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-1-yl]-N-cyclohexylformamide.
| Compound Name | N-[(1S,3aS,3bR,5aR,9aR,9bS,11aS)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-1-yl]-N-cyclohexylformamide |
|---|---|
| PubChem CID | 10409568 |
| Molecular Formula | C26H42N2O2 |
| Molecular Weight | 414.63 g/mol |
| Exact Mass | 414.32 |
| IUPAC Name | N-[(1S,3aS,3bR,5aR,9aR,9bS,11aS)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-1-yl]-N-cyclohexylformamide |
| SMILES | CN1C(=O)CC[C@]2(C)[C@H]3CC[C@]4(C)[C@@H](N(C=O)C5CCCCC5)CC[C@H]4[C@@H]3CC[C@@H]12 |
| InChI | InChI=1S/C26H42N2O2/c1-25-16-14-24(30)27(3)22(25)11-9-19-20-10-12-23(26(20,2)15-13-21(19)25)28(17-29)18-7-5-4-6-8-18/h17-23H,4-16H2,1-3H3/t19-,20-,21-,22+,23-,25+,26-/m0/s1 |
| InChIKey | GWOHHTZQGRQPDS-LMZXXRHXSA-N |
| XLogP | 5.01 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.63 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|