C20H33NO — CID 71056442
(9aR,11aR)-1,6,9a,11a-tetramethyl-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-7-one (PubChem CID 71056442) has the molecular formula C20H33NO and a molecular weight of 303.49 g/mol. Its IUPAC name is (9aR,11aR)-1,6,9a,11a-tetramethyl-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-7-one.
| Compound Name | (9aR,11aR)-1,6,9a,11a-tetramethyl-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-7-one |
|---|---|
| PubChem CID | 71056442 |
| Molecular Formula | C20H33NO |
| Molecular Weight | 303.49 g/mol |
| Exact Mass | 303.26 |
| IUPAC Name | (9aR,11aR)-1,6,9a,11a-tetramethyl-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-7-one |
| SMILES | CC1CCC2C3CCC4N(C)C(=O)CC[C@]4(C)C3CC[C@]12C |
| InChI | InChI=1S/C20H33NO/c1-13-5-7-15-14-6-8-17-20(3,12-10-18(22)21(17)4)16(14)9-11-19(13,15)2/h13-17H,5-12H2,1-4H3/t13?,14?,15?,16?,17?,19-,20-/m1/s1 |
| InChIKey | MDADBEJFOVOXRR-XPWHCFRESA-N |
| XLogP | 4.49 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.49 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |