C19H29NO — CID 11289197
(3aS,3bS,9aR,9bS,11aR)-6,9a,11a-trimethyl-3a,3b,4,5,5a,8,9,9b,10,11-decahydro-3H-indeno[5,4-f]quinolin-7-one (PubChem CID 11289197) has the molecular formula C19H29NO and a molecular weight of 287.45 g/mol. Its IUPAC name is (3aS,3bS,9aR,9bS,11aR)-6,9a,11a-trimethyl-3a,3b,4,5,5a,8,9,9b,10,11-decahydro-3H-indeno[5,4-f]quinolin-7-one.
| Compound Name | (3aS,3bS,9aR,9bS,11aR)-6,9a,11a-trimethyl-3a,3b,4,5,5a,8,9,9b,10,11-decahydro-3H-indeno[5,4-f]quinolin-7-one |
|---|---|
| PubChem CID | 11289197 |
| Molecular Formula | C19H29NO |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | (3aS,3bS,9aR,9bS,11aR)-6,9a,11a-trimethyl-3a,3b,4,5,5a,8,9,9b,10,11-decahydro-3H-indeno[5,4-f]quinolin-7-one |
| SMILES | CN1C(=O)CC[C@@]2(C)C1CC[C@H]1[C@@H]3CC=C[C@@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C19H29NO/c1-18-10-4-5-14(18)13-6-7-16-19(2,15(13)8-11-18)12-9-17(21)20(16)3/h4,10,13-16H,5-9,11-12H2,1-3H3/t13-,14-,15-,16?,18-,19+/m0/s1 |
| InChIKey | ZRKPNCPNVMCFFE-XYXPWHQESA-N |
| XLogP | 4.02 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|