C25H34ClNO2 — CID 57218643
(3aS,3bR,9aR,9bR,11aS)-1-(4-chlorophenoxy)-6,9a,11a-trimethyl-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-7-one (PubChem CID 57218643) has the molecular formula C25H34ClNO2 and a molecular weight of 416.01 g/mol. Its IUPAC name is (3aS,3bR,9aR,9bR,11aS)-1-(4-chlorophenoxy)-6,9a,11a-trimethyl-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-7-one.
| Compound Name | (3aS,3bR,9aR,9bR,11aS)-1-(4-chlorophenoxy)-6,9a,11a-trimethyl-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-7-one |
|---|---|
| PubChem CID | 57218643 |
| Molecular Formula | C25H34ClNO2 |
| Molecular Weight | 416.01 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | (3aS,3bR,9aR,9bR,11aS)-1-(4-chlorophenoxy)-6,9a,11a-trimethyl-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-7-one |
| SMILES | CN1C(=O)CC[C@@]2(C)C1CC[C@@H]1[C@H]2CC[C@]2(C)C(Oc3ccc(Cl)cc3)CC[C@@H]12 |
| InChI | InChI=1S/C25H34ClNO2/c1-24-15-13-23(28)27(3)21(24)10-8-18-19-9-11-22(25(19,2)14-12-20(18)24)29-17-6-4-16(26)5-7-17/h4-7,18-22H,8-15H2,1-3H3/t18-,19-,20+,21?,22?,24+,25-/m0/s1 |
| InChIKey | FQFVCNWAHGALQK-DJLXAZLCSA-N |
| XLogP | 5.95 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.01 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |