C29H41NO6 — CID 22849857
(3,4,5-trimethoxyphenyl) (1S,3aS,3bS,5aR,9aR,9bS,11aS)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinoline-1-carboxylate (PubChem CID 22849857) has the molecular formula C29H41NO6 and a molecular weight of 499.65 g/mol. Its IUPAC name is (3,4,5-trimethoxyphenyl) (1S,3aS,3bS,5aR,9aR,9bS,11aS)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinoline-1-carboxylate.
| Compound Name | (3,4,5-trimethoxyphenyl) (1S,3aS,3bS,5aR,9aR,9bS,11aS)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinoline-1-carboxylate |
|---|---|
| PubChem CID | 22849857 |
| Molecular Formula | C29H41NO6 |
| Molecular Weight | 499.65 g/mol |
| Exact Mass | 499.29 |
| IUPAC Name | (3,4,5-trimethoxyphenyl) (1S,3aS,3bS,5aR,9aR,9bS,11aS)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinoline-1-carboxylate |
| SMILES | COc1cc(OC(=O)[C@H]2CC[C@H]3[C@@H]4CC[C@H]5N(C)C(=O)CC[C@]5(C)[C@H]4CC[C@]23C)cc(OC)c1OC |
| InChI | InChI=1S/C29H41NO6/c1-28-13-11-20-18(7-10-24-29(20,2)14-12-25(31)30(24)3)19(28)8-9-21(28)27(32)36-17-15-22(33-4)26(35-6)23(16-17)34-5/h15-16,18-21,24H,7-14H2,1-6H3/t18-,19-,20-,21+,24+,28-,29+/m0/s1 |
| InChIKey | WUCPBYGGWQLLSW-LPGAFIJVSA-N |
| XLogP | 5.10 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.65 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|