C26H36ClNO2 — CID 57248405
(3aS,3bR,9aR,9bR,11aS)-1-(4-chlorophenoxy)-4,6,9a,11a-tetramethyl-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-7-one (PubChem CID 57248405) has the molecular formula C26H36ClNO2 and a molecular weight of 430.03 g/mol. Its IUPAC name is (3aS,3bR,9aR,9bR,11aS)-1-(4-chlorophenoxy)-4,6,9a,11a-tetramethyl-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-7-one.
| Compound Name | (3aS,3bR,9aR,9bR,11aS)-1-(4-chlorophenoxy)-4,6,9a,11a-tetramethyl-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-7-one |
|---|---|
| PubChem CID | 57248405 |
| Molecular Formula | C26H36ClNO2 |
| Molecular Weight | 430.03 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | (3aS,3bR,9aR,9bR,11aS)-1-(4-chlorophenoxy)-4,6,9a,11a-tetramethyl-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-7-one |
| SMILES | CC1CC2N(C)C(=O)CC[C@]2(C)[C@@H]2CC[C@]3(C)C(Oc4ccc(Cl)cc4)CC[C@H]3[C@H]12 |
| InChI | InChI=1S/C26H36ClNO2/c1-16-15-21-25(2,14-12-23(29)28(21)4)20-11-13-26(3)19(24(16)20)9-10-22(26)30-18-7-5-17(27)6-8-18/h5-8,16,19-22,24H,9-15H2,1-4H3/t16?,19-,20+,21?,22?,24-,25+,26-/m0/s1 |
| InChIKey | CZBBNYBGSLVWJE-FSXZEPKUSA-N |
| XLogP | 6.20 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.03 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |