C32H41NO2 — CID 70226369
(3aS,3bS,9aR,9bR,11aR)-4,6,9a,11a-tetramethyl-2-(4-phenylphenoxy)-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-7-one (PubChem CID 70226369) has the molecular formula C32H41NO2 and a molecular weight of 471.69 g/mol. Its IUPAC name is (3aS,3bS,9aR,9bR,11aR)-4,6,9a,11a-tetramethyl-2-(4-phenylphenoxy)-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-7-one.
| Compound Name | (3aS,3bS,9aR,9bR,11aR)-4,6,9a,11a-tetramethyl-2-(4-phenylphenoxy)-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-7-one |
|---|---|
| PubChem CID | 70226369 |
| Molecular Formula | C32H41NO2 |
| Molecular Weight | 471.69 g/mol |
| Exact Mass | 471.31 |
| IUPAC Name | (3aS,3bS,9aR,9bR,11aR)-4,6,9a,11a-tetramethyl-2-(4-phenylphenoxy)-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-7-one |
| SMILES | CC1CC2N(C)C(=O)CC[C@]2(C)[C@@H]2CC[C@]3(C)CC(Oc4ccc(-c5ccccc5)cc4)C[C@H]3[C@H]12 |
| InChI | InChI=1S/C32H41NO2/c1-21-18-28-32(3,17-15-29(34)33(28)4)26-14-16-31(2)20-25(19-27(31)30(21)26)35-24-12-10-23(11-13-24)22-8-6-5-7-9-22/h5-13,21,25-28,30H,14-20H2,1-4H3/t21?,25?,26-,27+,28?,30-,31-,32-/m1/s1 |
| InChIKey | YRCIBMWRIOPPNV-SKWRTCAVSA-N |
| XLogP | 7.21 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.69 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |