C27H38ClNO — CID 51016294
(3aS,5aR,9aR,9bS,11aR)-2-[(4-chlorophenyl)methyl]-4,6,9a,11a-tetramethyl-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-7-one (PubChem CID 51016294) has the molecular formula C27H38ClNO and a molecular weight of 428.06 g/mol. Its IUPAC name is (3aS,5aR,9aR,9bS,11aR)-2-[(4-chlorophenyl)methyl]-4,6,9a,11a-tetramethyl-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-7-one.
| Compound Name | (3aS,5aR,9aR,9bS,11aR)-2-[(4-chlorophenyl)methyl]-4,6,9a,11a-tetramethyl-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-7-one |
|---|---|
| PubChem CID | 51016294 |
| Molecular Formula | C27H38ClNO |
| Molecular Weight | 428.06 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | (3aS,5aR,9aR,9bS,11aR)-2-[(4-chlorophenyl)methyl]-4,6,9a,11a-tetramethyl-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-7-one |
| SMILES | CC1C[C@H]2N(C)C(=O)CC[C@]2(C)[C@H]2CC[C@]3(C)CC(Cc4ccc(Cl)cc4)C[C@H]3C12 |
| InChI | InChI=1S/C27H38ClNO/c1-17-13-23-27(3,12-10-24(30)29(23)4)21-9-11-26(2)16-19(15-22(26)25(17)21)14-18-5-7-20(28)8-6-18/h5-8,17,19,21-23,25H,9-16H2,1-4H3/t17?,19?,21-,22-,23+,25?,26+,27+/m0/s1 |
| InChIKey | BENPDWMOYFDCDE-FVEMBWJRSA-N |
| XLogP | 6.61 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.06 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |