C27H34F3NO2 — CID 57296193
(3aS,3bS,9aR,9bR,11aR)-4,5,9a,11a-tetramethyl-2-[4-(trifluoromethyl)phenoxy]-2,3,3a,3b,4,8,9,9b,10,11-decahydro-1H-cyclopenta[i]phenanthridin-7-one (PubChem CID 57296193) has the molecular formula C27H34F3NO2 and a molecular weight of 461.57 g/mol. Its IUPAC name is (3aS,3bS,9aR,9bR,11aR)-4,5,9a,11a-tetramethyl-2-[4-(trifluoromethyl)phenoxy]-2,3,3a,3b,4,8,9,9b,10,11-decahydro-1H-cyclopenta[i]phenanthridin-7-one.
| Compound Name | (3aS,3bS,9aR,9bR,11aR)-4,5,9a,11a-tetramethyl-2-[4-(trifluoromethyl)phenoxy]-2,3,3a,3b,4,8,9,9b,10,11-decahydro-1H-cyclopenta[i]phenanthridin-7-one |
|---|---|
| PubChem CID | 57296193 |
| Molecular Formula | C27H34F3NO2 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.25 |
| IUPAC Name | (3aS,3bS,9aR,9bR,11aR)-4,5,9a,11a-tetramethyl-2-[4-(trifluoromethyl)phenoxy]-2,3,3a,3b,4,8,9,9b,10,11-decahydro-1H-cyclopenta[i]phenanthridin-7-one |
| SMILES | CC1[C@@H]2[C@@H](CC[C@]3(C)CC(Oc4ccc(C(F)(F)F)cc4)C[C@@H]23)[C@@]2(C)CCC(=O)C=C2N1C |
| InChI | InChI=1S/C27H34F3NO2/c1-16-24-21(26(3)12-9-18(32)13-23(26)31(16)4)10-11-25(2)15-20(14-22(24)25)33-19-7-5-17(6-8-19)27(28,29)30/h5-8,13,16,20-22,24H,9-12,14-15H2,1-4H3/t16?,20?,21-,22+,24-,25-,26-/m1/s1 |
| InChIKey | GOCPGMGJZCKKRB-GZMMHFATSA-N |
| XLogP | 6.48 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |