C19H20F3NO5 — CID 66932947
(E)-2-[8-methyl-3-[4-(trifluoromethyl)phenoxy]-8-azabicyclo[3.2.1]octan-1-yl]but-2-enedioic acid (PubChem CID 66932947) has the molecular formula C19H20F3NO5 and a molecular weight of 399.37 g/mol. Its IUPAC name is (E)-2-[8-methyl-3-[4-(trifluoromethyl)phenoxy]-8-azabicyclo[3.2.1]octan-1-yl]but-2-enedioic acid.
| Compound Name | (E)-2-[8-methyl-3-[4-(trifluoromethyl)phenoxy]-8-azabicyclo[3.2.1]octan-1-yl]but-2-enedioic acid |
|---|---|
| PubChem CID | 66932947 |
| Molecular Formula | C19H20F3NO5 |
| Molecular Weight | 399.37 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | (E)-2-[8-methyl-3-[4-(trifluoromethyl)phenoxy]-8-azabicyclo[3.2.1]octan-1-yl]but-2-enedioic acid |
| SMILES | CN1C2CCC1(/C(=C\C(=O)O)C(=O)O)CC(Oc1ccc(C(F)(F)F)cc1)C2 |
| InChI | InChI=1S/C19H20F3NO5/c1-23-12-6-7-18(23,15(17(26)27)9-16(24)25)10-14(8-12)28-13-4-2-11(3-5-13)19(20,21)22/h2-5,9,12,14H,6-8,10H2,1H3,(H,24,25)(H,26,27)/b15-9- |
| InChIKey | CJXOFTPQTGMDPH-DHDCSXOGSA-N |
| XLogP | 3.18 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|