C30H34Cl2N2O6 — CID 66933162
bis[3-(4-chlorophenoxy)-8-methyl-8-azabicyclo[3.2.1]octan-1-yl] oxalate (PubChem CID 66933162) has the molecular formula C30H34Cl2N2O6 and a molecular weight of 589.52 g/mol. Its IUPAC name is bis[3-(4-chlorophenoxy)-8-methyl-8-azabicyclo[3.2.1]octan-1-yl] oxalate.
| Compound Name | bis[3-(4-chlorophenoxy)-8-methyl-8-azabicyclo[3.2.1]octan-1-yl] oxalate |
|---|---|
| PubChem CID | 66933162 |
| Molecular Formula | C30H34Cl2N2O6 |
| Molecular Weight | 589.52 g/mol |
| Exact Mass | 588.18 |
| IUPAC Name | bis[3-(4-chlorophenoxy)-8-methyl-8-azabicyclo[3.2.1]octan-1-yl] oxalate |
| SMILES | CN1C2CCC1(OC(=O)C(=O)OC13CCC(CC(Oc4ccc(Cl)cc4)C1)N3C)CC(Oc1ccc(Cl)cc1)C2 |
| InChI | InChI=1S/C30H34Cl2N2O6/c1-33-21-11-13-29(33,17-25(15-21)37-23-7-3-19(31)4-8-23)39-27(35)28(36)40-30-14-12-22(34(30)2)16-26(18-30)38-24-9-5-20(32)6-10-24/h3-10,21-22,25-26H,11-18H2,1-2H3 |
| InChIKey | HATGSAGHIAGDNA-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.52 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|