C21H22N2O5 — CID 66933250
(E)-2-(8-methyl-3-quinolin-6-yloxy-8-azabicyclo[3.2.1]octan-1-yl)but-2-enedioic acid (PubChem CID 66933250) has the molecular formula C21H22N2O5 and a molecular weight of 382.42 g/mol. Its IUPAC name is (E)-2-(8-methyl-3-quinolin-6-yloxy-8-azabicyclo[3.2.1]octan-1-yl)but-2-enedioic acid.
| Compound Name | (E)-2-(8-methyl-3-quinolin-6-yloxy-8-azabicyclo[3.2.1]octan-1-yl)but-2-enedioic acid |
|---|---|
| PubChem CID | 66933250 |
| Molecular Formula | C21H22N2O5 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | (E)-2-(8-methyl-3-quinolin-6-yloxy-8-azabicyclo[3.2.1]octan-1-yl)but-2-enedioic acid |
| SMILES | CN1C2CCC1(/C(=C\C(=O)O)C(=O)O)CC(Oc1ccc3ncccc3c1)C2 |
| InChI | InChI=1S/C21H22N2O5/c1-23-14-6-7-21(23,17(20(26)27)11-19(24)25)12-16(10-14)28-15-4-5-18-13(9-15)3-2-8-22-18/h2-5,8-9,11,14,16H,6-7,10,12H2,1H3,(H,24,25)(H,26,27)/b17-11- |
| InChIKey | XKCHNNCFSDOMEA-BOPFTXTBSA-N |
| XLogP | 2.70 |
| TPSA | 99.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|