C30H31N3O2S — CID 42432820
(E)-1-[4-[4-[[methyl(quinolin-6-ylmethyl)amino]methyl]phenoxy]piperidin-1-yl]-3-thiophen-2-ylprop-2-en-1-one (PubChem CID 42432820) has the molecular formula C30H31N3O2S and a molecular weight of 497.66 g/mol. Its IUPAC name is (E)-1-[4-[4-[[methyl(quinolin-6-ylmethyl)amino]methyl]phenoxy]piperidin-1-yl]-3-thiophen-2-ylprop-2-en-1-one.
| Compound Name | (E)-1-[4-[4-[[methyl(quinolin-6-ylmethyl)amino]methyl]phenoxy]piperidin-1-yl]-3-thiophen-2-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 42432820 |
| Molecular Formula | C30H31N3O2S |
| Molecular Weight | 497.66 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | (E)-1-[4-[4-[[methyl(quinolin-6-ylmethyl)amino]methyl]phenoxy]piperidin-1-yl]-3-thiophen-2-ylprop-2-en-1-one |
| SMILES | CN(Cc1ccc(OC2CCN(C(=O)/C=C/c3cccs3)CC2)cc1)Cc1ccc2ncccc2c1 |
| InChI | InChI=1S/C30H31N3O2S/c1-32(22-24-8-12-29-25(20-24)4-2-16-31-29)21-23-6-9-26(10-7-23)35-27-14-17-33(18-15-27)30(34)13-11-28-5-3-19-36-28/h2-13,16,19-20,27H,14-15,17-18,21-22H2,1H3/b13-11+ |
| InChIKey | IADCWLLZVQYFNW-ACCUITESSA-N |
| XLogP | 6.01 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.66 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|