C26H26N4OS — CID 42164508
(E)-1-[4-[2-(2-phenylethyl)imidazo[4,5-b]pyridin-3-yl]piperidin-1-yl]-3-thiophen-2-ylprop-2-en-1-one (PubChem CID 42164508) has the molecular formula C26H26N4OS and a molecular weight of 442.59 g/mol. Its IUPAC name is (E)-1-[4-[2-(2-phenylethyl)imidazo[4,5-b]pyridin-3-yl]piperidin-1-yl]-3-thiophen-2-ylprop-2-en-1-one.
| Compound Name | (E)-1-[4-[2-(2-phenylethyl)imidazo[4,5-b]pyridin-3-yl]piperidin-1-yl]-3-thiophen-2-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 42164508 |
| Molecular Formula | C26H26N4OS |
| Molecular Weight | 442.59 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | (E)-1-[4-[2-(2-phenylethyl)imidazo[4,5-b]pyridin-3-yl]piperidin-1-yl]-3-thiophen-2-ylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1cccs1)N1CCC(n2c(CCc3ccccc3)nc3cccnc32)CC1 |
| InChI | InChI=1S/C26H26N4OS/c31-25(13-11-22-8-5-19-32-22)29-17-14-21(15-18-29)30-24(12-10-20-6-2-1-3-7-20)28-23-9-4-16-27-26(23)30/h1-9,11,13,16,19,21H,10,12,14-15,17-18H2/b13-11+ |
| InChIKey | RAZJUXMDYSSDKA-ACCUITESSA-N |
| XLogP | 5.15 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.59 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|