C26H28N6O2 — CID 171138300
3-(1H-imidazol-5-yl)-1-[4-[2-[2-(4-methoxyphenyl)ethyl]imidazo[4,5-b]pyridin-3-yl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 171138300) has the molecular formula C26H28N6O2 and a molecular weight of 456.55 g/mol. Its IUPAC name is 3-(1H-imidazol-5-yl)-1-[4-[2-[2-(4-methoxyphenyl)ethyl]imidazo[4,5-b]pyridin-3-yl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 3-(1H-imidazol-5-yl)-1-[4-[2-[2-(4-methoxyphenyl)ethyl]imidazo[4,5-b]pyridin-3-yl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 171138300 |
| Molecular Formula | C26H28N6O2 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.23 |
| IUPAC Name | 3-(1H-imidazol-5-yl)-1-[4-[2-[2-(4-methoxyphenyl)ethyl]imidazo[4,5-b]pyridin-3-yl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | COc1ccc(CCc2nc3cccnc3n2C2CCN(C(=O)C=Cc3cnc[nH]3)CC2)cc1 |
| InChI | InChI=1S/C26H28N6O2/c1-34-22-8-4-19(5-9-22)6-10-24-30-23-3-2-14-28-26(23)32(24)21-12-15-31(16-13-21)25(33)11-7-20-17-27-18-29-20/h2-5,7-9,11,14,17-18,21H,6,10,12-13,15-16H2,1H3,(H,27,29) |
| InChIKey | NHZWKRJUIFTVJW-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 88.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|