C29H32ClN3O2S — CID 74801065
1-[4-[4-[[4-(3-chlorophenyl)piperazin-1-yl]methyl]phenoxy]piperidin-1-yl]-3-thiophen-2-ylprop-2-en-1-one (PubChem CID 74801065) has the molecular formula C29H32ClN3O2S and a molecular weight of 522.11 g/mol. Its IUPAC name is 1-[4-[4-[[4-(3-chlorophenyl)piperazin-1-yl]methyl]phenoxy]piperidin-1-yl]-3-thiophen-2-ylprop-2-en-1-one.
| Compound Name | 1-[4-[4-[[4-(3-chlorophenyl)piperazin-1-yl]methyl]phenoxy]piperidin-1-yl]-3-thiophen-2-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 74801065 |
| Molecular Formula | C29H32ClN3O2S |
| Molecular Weight | 522.11 g/mol |
| Exact Mass | 521.19 |
| IUPAC Name | 1-[4-[4-[[4-(3-chlorophenyl)piperazin-1-yl]methyl]phenoxy]piperidin-1-yl]-3-thiophen-2-ylprop-2-en-1-one |
| SMILES | O=C(C=Cc1cccs1)N1CCC(Oc2ccc(CN3CCN(c4cccc(Cl)c4)CC3)cc2)CC1 |
| InChI | InChI=1S/C29H32ClN3O2S/c30-24-3-1-4-25(21-24)32-18-16-31(17-19-32)22-23-6-8-26(9-7-23)35-27-12-14-33(15-13-27)29(34)11-10-28-5-2-20-36-28/h1-11,20-21,27H,12-19,22H2 |
| InChIKey | YUJPUMZPNPRWND-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.11 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|