C26H28N2O5 — CID 20738217
4-[[1-(3-methylbutanoyl)-4-quinolin-6-yloxypyrrolidin-2-yl]methoxy]benzoic acid (PubChem CID 20738217) has the molecular formula C26H28N2O5 and a molecular weight of 448.52 g/mol. Its IUPAC name is 4-[[1-(3-methylbutanoyl)-4-quinolin-6-yloxypyrrolidin-2-yl]methoxy]benzoic acid.
| Compound Name | 4-[[1-(3-methylbutanoyl)-4-quinolin-6-yloxypyrrolidin-2-yl]methoxy]benzoic acid |
|---|---|
| PubChem CID | 20738217 |
| Molecular Formula | C26H28N2O5 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | 4-[[1-(3-methylbutanoyl)-4-quinolin-6-yloxypyrrolidin-2-yl]methoxy]benzoic acid |
| SMILES | CC(C)CC(=O)N1CC(Oc2ccc3ncccc3c2)CC1COc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C26H28N2O5/c1-17(2)12-25(29)28-15-23(33-22-9-10-24-19(13-22)4-3-11-27-24)14-20(28)16-32-21-7-5-18(6-8-21)26(30)31/h3-11,13,17,20,23H,12,14-16H2,1-2H3,(H,30,31) |
| InChIKey | AAQVLKWWEFGMJN-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |